About 5,6-bis(ethenyl)-3-iminoocta-1,5,7-trien-4-one
5,6-bis(ethenyl)-3-iminoocta-1,5,7-trien-4-one (PubChem CID 146326376) has the molecular formula C12H13NO
and a molecular weight of 187.24 g/mol. Its IUPAC name is 5,6-bis(ethenyl)-3-iminoocta-1,5,7-trien-4-one.
Molecular Properties
| Compound Name | 5,6-bis(ethenyl)-3-iminoocta-1,5,7-trien-4-one |
| PubChem CID | 146326376 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 5,6-bis(ethenyl)-3-iminoocta-1,5,7-trien-4-one |
| SMILES | [H]/N=C(\C=C)C(=O)C(C=C)=C(C=C)C=C |
| InChI | InChI=1S/C12H13NO/c1-5-9(6-2)10(7-3)12(14)11(13)8-4/h5-8,13H,1-4H2/b13-11+ |
| InChIKey | CVLJHJZAVXHMLA-ACCUITESSA-N |
| XLogP | 2.62 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5,6-bis(ethenyl)-3-iminoocta-1,5,7-trien-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-bis(ethenyl)-3-iminoocta-1,5,7-trien-4-one?
The IUPAC name of 5,6-bis(ethenyl)-3-iminoocta-1,5,7-trien-4-one (CID 146326376) is 5,6-bis(ethenyl)-3-iminoocta-1,5,7-trien-4-one.
What is the SMILES notation for 5,6-bis(ethenyl)-3-iminoocta-1,5,7-trien-4-one?
The canonical SMILES for 5,6-bis(ethenyl)-3-iminoocta-1,5,7-trien-4-one is [H]/N=C(\C=C)C(=O)C(C=C)=C(C=C)C=C.
What is the InChIKey of 5,6-bis(ethenyl)-3-iminoocta-1,5,7-trien-4-one?
The InChIKey is CVLJHJZAVXHMLA-ACCUITESSA-N. The full InChI is InChI=1S/C12H13NO/c1-5-9(6-2)10(7-3)12(14)11(13)8-4/h5-8,13H,1-4H2/b13-11+.
What are the key properties of 5,6-bis(ethenyl)-3-iminoocta-1,5,7-trien-4-one?
5,6-bis(ethenyl)-3-iminoocta-1,5,7-trien-4-one has a molecular weight of 187.24 g/mol, XLogP of 2.62, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-bis(ethenyl)-3-iminoocta-1,5,7-trien-4-one is sourced from PubChem (CID 146326376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).