C24H40N2O14S3 — CID 146326482
3-[5-[[7-(methylamino)-2-oxoheptan-3-yl]carbamoyl]-2,3-bis(3-sulfopropoxy)phenoxy]propane-1-sulfonic acid (PubChem CID 146326482) has the molecular formula C24H40N2O14S3 and a molecular weight of 676.78 g/mol. Its IUPAC name is 3-[5-[[7-(methylamino)-2-oxoheptan-3-yl]carbamoyl]-2,3-bis(3-sulfopropoxy)phenoxy]propane-1-sulfonic acid.
| Compound Name | 3-[5-[[7-(methylamino)-2-oxoheptan-3-yl]carbamoyl]-2,3-bis(3-sulfopropoxy)phenoxy]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 146326482 |
| Molecular Formula | C24H40N2O14S3 |
| Molecular Weight | 676.78 g/mol |
| Exact Mass | 676.16 |
| IUPAC Name | 3-[5-[[7-(methylamino)-2-oxoheptan-3-yl]carbamoyl]-2,3-bis(3-sulfopropoxy)phenoxy]propane-1-sulfonic acid |
| SMILES | CNCCCCC(NC(=O)c1cc(OCCCS(=O)(=O)O)c(OCCCS(=O)(=O)O)c(OCCCS(=O)(=O)O)c1)C(C)=O |
| InChI | InChI=1S/C24H40N2O14S3/c1-18(27)20(8-3-4-9-25-2)26-24(28)19-16-21(38-10-5-13-41(29,30)31)23(40-12-7-15-43(35,36)37)22(17-19)39-11-6-14-42(32,33)34/h16-17,20,25H,3-15H2,1-2H3,(H,26,28)(H,29,30,31)(H,32,33,34)(H,35,36,37) |
| InChIKey | KRAFNVJATOEVPU-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 249.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.78 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|