C12H7F17O — CID 146326563
1,1,1,4,5,5,5-heptafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-propan-2-yloxy-4-(trifluoromethyl)pent-2-ene (PubChem CID 146326563) has the molecular formula C12H7F17O and a molecular weight of 490.15 g/mol. Its IUPAC name is 1,1,1,4,5,5,5-heptafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-propan-2-yloxy-4-(trifluoromethyl)pent-2-ene.
| Compound Name | 1,1,1,4,5,5,5-heptafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-propan-2-yloxy-4-(trifluoromethyl)pent-2-ene |
|---|---|
| PubChem CID | 146326563 |
| Molecular Formula | C12H7F17O |
| Molecular Weight | 490.15 g/mol |
| Exact Mass | 490.02 |
| IUPAC Name | 1,1,1,4,5,5,5-heptafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-propan-2-yloxy-4-(trifluoromethyl)pent-2-ene |
| SMILES | CC(C)OC(=C(C(F)(C(F)(F)F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H7F17O/c1-3(2)30-5(8(15,16)17)4(6(13,9(18,19)20)10(21,22)23)7(14,11(24,25)26)12(27,28)29/h3H,1-2H3 |
| InChIKey | FQXQXNPPLOMLJV-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.15 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|