About N,N'-dimethyl-N'-(5-methylhex-1-en-2-yl)-N-pent-1-en-2-ylmethanediamine
N,N'-dimethyl-N'-(5-methylhex-1-en-2-yl)-N-pent-1-en-2-ylmethanediamine (PubChem CID 146326665) has the molecular formula C15H30N2
and a molecular weight of 238.42 g/mol. Its IUPAC name is N,N'-dimethyl-N'-(5-methylhex-1-en-2-yl)-N-pent-1-en-2-ylmethanediamine.
Molecular Properties
| Compound Name | N,N'-dimethyl-N'-(5-methylhex-1-en-2-yl)-N-pent-1-en-2-ylmethanediamine |
| PubChem CID | 146326665 |
| Molecular Formula | C15H30N2 |
| Molecular Weight | 238.42 g/mol |
| Exact Mass | 238.24 |
| IUPAC Name | N,N'-dimethyl-N'-(5-methylhex-1-en-2-yl)-N-pent-1-en-2-ylmethanediamine |
| SMILES | C=C(CCC)N(C)CN(C)C(=C)CCC(C)C |
| InChI | InChI=1S/C15H30N2/c1-8-9-14(4)16(6)12-17(7)15(5)11-10-13(2)3/h13H,4-5,8-12H2,1-3,6-7H3 |
| InChIKey | QHWISAWSPLNGHQ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.42 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N,N'-dimethyl-N'-(5-methylhex-1-en-2-yl)-N-pent-1-en-2-ylmethanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-dimethyl-N'-(5-methylhex-1-en-2-yl)-N-pent-1-en-2-ylmethanediamine?
The IUPAC name of N,N'-dimethyl-N'-(5-methylhex-1-en-2-yl)-N-pent-1-en-2-ylmethanediamine (CID 146326665) is N,N'-dimethyl-N'-(5-methylhex-1-en-2-yl)-N-pent-1-en-2-ylmethanediamine.
What is the SMILES notation for N,N'-dimethyl-N'-(5-methylhex-1-en-2-yl)-N-pent-1-en-2-ylmethanediamine?
The canonical SMILES for N,N'-dimethyl-N'-(5-methylhex-1-en-2-yl)-N-pent-1-en-2-ylmethanediamine is C=C(CCC)N(C)CN(C)C(=C)CCC(C)C.
What is the InChIKey of N,N'-dimethyl-N'-(5-methylhex-1-en-2-yl)-N-pent-1-en-2-ylmethanediamine?
The InChIKey is QHWISAWSPLNGHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30N2/c1-8-9-14(4)16(6)12-17(7)15(5)11-10-13(2)3/h13H,4-5,8-12H2,1-3,6-7H3.
What are the key properties of N,N'-dimethyl-N'-(5-methylhex-1-en-2-yl)-N-pent-1-en-2-ylmethanediamine?
N,N'-dimethyl-N'-(5-methylhex-1-en-2-yl)-N-pent-1-en-2-ylmethanediamine has a molecular weight of 238.42 g/mol, XLogP of 4.07, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-dimethyl-N'-(5-methylhex-1-en-2-yl)-N-pent-1-en-2-ylmethanediamine is sourced from PubChem (CID 146326665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).