About methyl 4-[(1E,3Z)-pentadeca-1,3-dien-6-ynyl]sulfanylbutanoate
methyl 4-[(1E,3Z)-pentadeca-1,3-dien-6-ynyl]sulfanylbutanoate (PubChem CID 14632677) has the molecular formula C20H32O2S
and a molecular weight of 336.54 g/mol. Its IUPAC name is methyl 4-[(1E,3Z)-pentadeca-1,3-dien-6-ynyl]sulfanylbutanoate.
Molecular Properties
| Compound Name | methyl 4-[(1E,3Z)-pentadeca-1,3-dien-6-ynyl]sulfanylbutanoate |
| PubChem CID | 14632677 |
| Molecular Formula | C20H32O2S |
| Molecular Weight | 336.54 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | methyl 4-[(1E,3Z)-pentadeca-1,3-dien-6-ynyl]sulfanylbutanoate |
| SMILES | CCCCCCCCC#CC/C=C\C=C\SCCCC(=O)OC |
| InChI | InChI=1S/C20H32O2S/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-18-23-19-16-17-20(21)22-2/h13-15,18H,3-9,12,16-17,19H2,1-2H3/b14-13-,18-15+ |
| InChIKey | NXYCNVKEVANDDC-XDQHYEHBSA-N |
| XLogP | 5.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.54 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-[(1E,3Z)-pentadeca-1,3-dien-6-ynyl]sulfanylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[(1E,3Z)-pentadeca-1,3-dien-6-ynyl]sulfanylbutanoate?
The IUPAC name of methyl 4-[(1E,3Z)-pentadeca-1,3-dien-6-ynyl]sulfanylbutanoate (CID 14632677) is methyl 4-[(1E,3Z)-pentadeca-1,3-dien-6-ynyl]sulfanylbutanoate.
What is the SMILES notation for methyl 4-[(1E,3Z)-pentadeca-1,3-dien-6-ynyl]sulfanylbutanoate?
The canonical SMILES for methyl 4-[(1E,3Z)-pentadeca-1,3-dien-6-ynyl]sulfanylbutanoate is CCCCCCCCC#CC/C=C\C=C\SCCCC(=O)OC.
What is the InChIKey of methyl 4-[(1E,3Z)-pentadeca-1,3-dien-6-ynyl]sulfanylbutanoate?
The InChIKey is NXYCNVKEVANDDC-XDQHYEHBSA-N. The full InChI is InChI=1S/C20H32O2S/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-18-23-19-16-17-20(21)22-2/h13-15,18H,3-9,12,16-17,19H2,1-2H3/b14-13-,18-15+.
What are the key properties of methyl 4-[(1E,3Z)-pentadeca-1,3-dien-6-ynyl]sulfanylbutanoate?
methyl 4-[(1E,3Z)-pentadeca-1,3-dien-6-ynyl]sulfanylbutanoate has a molecular weight of 336.54 g/mol, XLogP of 5.89, 13 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(1E,3Z)-pentadeca-1,3-dien-6-ynyl]sulfanylbutanoate is sourced from PubChem (CID 14632677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).