C23H32O2S — CID 14632687
methyl 3-[(1E,3Z,6Z)-pentadeca-1,3,6-trienyl]sulfanylbenzoate (PubChem CID 14632687) has the molecular formula C23H32O2S and a molecular weight of 372.57 g/mol. Its IUPAC name is methyl 3-[(1E,3Z,6Z)-pentadeca-1,3,6-trienyl]sulfanylbenzoate.
| Compound Name | methyl 3-[(1E,3Z,6Z)-pentadeca-1,3,6-trienyl]sulfanylbenzoate |
|---|---|
| PubChem CID | 14632687 |
| Molecular Formula | C23H32O2S |
| Molecular Weight | 372.57 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | methyl 3-[(1E,3Z,6Z)-pentadeca-1,3,6-trienyl]sulfanylbenzoate |
| SMILES | CCCCCCCC/C=C\C/C=C\C=C\Sc1cccc(C(=O)OC)c1 |
| InChI | InChI=1S/C23H32O2S/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-19-26-22-18-16-17-21(20-22)23(24)25-2/h10-11,13-20H,3-9,12H2,1-2H3/b11-10-,14-13-,19-15+ |
| InChIKey | LSCPGNUHRNLUTC-PIZVHZJPSA-N |
| XLogP | 7.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.57 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|