About methyl 3-[(1E,3Z)-pentadeca-1,3-dien-6-ynyl]sulfanylbenzoate
methyl 3-[(1E,3Z)-pentadeca-1,3-dien-6-ynyl]sulfanylbenzoate (PubChem CID 14632693) has the molecular formula C23H30O2S
and a molecular weight of 370.56 g/mol. Its IUPAC name is methyl 3-[(1E,3Z)-pentadeca-1,3-dien-6-ynyl]sulfanylbenzoate.
Molecular Properties
| Compound Name | methyl 3-[(1E,3Z)-pentadeca-1,3-dien-6-ynyl]sulfanylbenzoate |
| PubChem CID | 14632693 |
| Molecular Formula | C23H30O2S |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | methyl 3-[(1E,3Z)-pentadeca-1,3-dien-6-ynyl]sulfanylbenzoate |
| SMILES | CCCCCCCCC#CC/C=C\C=C\Sc1cccc(C(=O)OC)c1 |
| InChI | InChI=1S/C23H30O2S/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-19-26-22-18-16-17-21(20-22)23(24)25-2/h13-20H,3-9,12H2,1-2H3/b14-13-,19-15+ |
| InChIKey | RVYVEFPIDDSYLV-GCYSJDCNSA-N |
| XLogP | 6.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-[(1E,3Z)-pentadeca-1,3-dien-6-ynyl]sulfanylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[(1E,3Z)-pentadeca-1,3-dien-6-ynyl]sulfanylbenzoate?
The IUPAC name of methyl 3-[(1E,3Z)-pentadeca-1,3-dien-6-ynyl]sulfanylbenzoate (CID 14632693) is methyl 3-[(1E,3Z)-pentadeca-1,3-dien-6-ynyl]sulfanylbenzoate.
What is the SMILES notation for methyl 3-[(1E,3Z)-pentadeca-1,3-dien-6-ynyl]sulfanylbenzoate?
The canonical SMILES for methyl 3-[(1E,3Z)-pentadeca-1,3-dien-6-ynyl]sulfanylbenzoate is CCCCCCCCC#CC/C=C\C=C\Sc1cccc(C(=O)OC)c1.
What is the InChIKey of methyl 3-[(1E,3Z)-pentadeca-1,3-dien-6-ynyl]sulfanylbenzoate?
The InChIKey is RVYVEFPIDDSYLV-GCYSJDCNSA-N. The full InChI is InChI=1S/C23H30O2S/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-19-26-22-18-16-17-21(20-22)23(24)25-2/h13-20H,3-9,12H2,1-2H3/b14-13-,19-15+.
What are the key properties of methyl 3-[(1E,3Z)-pentadeca-1,3-dien-6-ynyl]sulfanylbenzoate?
methyl 3-[(1E,3Z)-pentadeca-1,3-dien-6-ynyl]sulfanylbenzoate has a molecular weight of 370.56 g/mol, XLogP of 6.78, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(1E,3Z)-pentadeca-1,3-dien-6-ynyl]sulfanylbenzoate is sourced from PubChem (CID 14632693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).