C19H32O2S — CID 14632697
4-[(1E,3Z,6Z)-pentadeca-1,3,6-trienyl]sulfanylbutanoic acid (PubChem CID 14632697) has the molecular formula C19H32O2S and a molecular weight of 324.53 g/mol. Its IUPAC name is 4-[(1E,3Z,6Z)-pentadeca-1,3,6-trienyl]sulfanylbutanoic acid.
| Compound Name | 4-[(1E,3Z,6Z)-pentadeca-1,3,6-trienyl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 14632697 |
| Molecular Formula | C19H32O2S |
| Molecular Weight | 324.53 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | 4-[(1E,3Z,6Z)-pentadeca-1,3,6-trienyl]sulfanylbutanoic acid |
| SMILES | CCCCCCCC/C=C\C/C=C\C=C\SCCCC(=O)O |
| InChI | InChI=1S/C19H32O2S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17-22-18-15-16-19(20)21/h9-10,12-14,17H,2-8,11,15-16,18H2,1H3,(H,20,21)/b10-9-,13-12-,17-14+ |
| InChIKey | YRBDHTFMZHCRCL-MPAZIYIRSA-N |
| XLogP | 6.35 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.53 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|