About 7-[3,3-difluoro-5-[7-(3-hydroxy-4-methylphenyl)heptyl]-2-oxopyrrolidin-1-yl]heptanoic acid
7-[3,3-difluoro-5-[7-(3-hydroxy-4-methylphenyl)heptyl]-2-oxopyrrolidin-1-yl]heptanoic acid (PubChem CID 146327414) has the molecular formula C25H37F2NO4
and a molecular weight of 453.57 g/mol. Its IUPAC name is 7-[3,3-difluoro-5-[7-(3-hydroxy-4-methylphenyl)heptyl]-2-oxopyrrolidin-1-yl]heptanoic acid.
Molecular Properties
| Compound Name | 7-[3,3-difluoro-5-[7-(3-hydroxy-4-methylphenyl)heptyl]-2-oxopyrrolidin-1-yl]heptanoic acid |
| PubChem CID | 146327414 |
| Molecular Formula | C25H37F2NO4 |
| Molecular Weight | 453.57 g/mol |
| Exact Mass | 453.27 |
| IUPAC Name | 7-[3,3-difluoro-5-[7-(3-hydroxy-4-methylphenyl)heptyl]-2-oxopyrrolidin-1-yl]heptanoic acid |
| SMILES | Cc1ccc(CCCCCCCC2CC(F)(F)C(=O)N2CCCCCCC(=O)O)cc1O |
| InChI | InChI=1S/C25H37F2NO4/c1-19-14-15-20(17-22(19)29)11-7-3-2-4-8-12-21-18-25(26,27)24(32)28(21)16-10-6-5-9-13-23(30)31/h14-15,17,21,29H,2-13,16,18H2,1H3,(H,30,31) |
| InChIKey | RFBWAICVSYFQHI-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.57 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-[3,3-difluoro-5-[7-(3-hydroxy-4-methylphenyl)heptyl]-2-oxopyrrolidin-1-yl]heptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[3,3-difluoro-5-[7-(3-hydroxy-4-methylphenyl)heptyl]-2-oxopyrrolidin-1-yl]heptanoic acid?
The IUPAC name of 7-[3,3-difluoro-5-[7-(3-hydroxy-4-methylphenyl)heptyl]-2-oxopyrrolidin-1-yl]heptanoic acid (CID 146327414) is 7-[3,3-difluoro-5-[7-(3-hydroxy-4-methylphenyl)heptyl]-2-oxopyrrolidin-1-yl]heptanoic acid.
What is the SMILES notation for 7-[3,3-difluoro-5-[7-(3-hydroxy-4-methylphenyl)heptyl]-2-oxopyrrolidin-1-yl]heptanoic acid?
The canonical SMILES for 7-[3,3-difluoro-5-[7-(3-hydroxy-4-methylphenyl)heptyl]-2-oxopyrrolidin-1-yl]heptanoic acid is Cc1ccc(CCCCCCCC2CC(F)(F)C(=O)N2CCCCCCC(=O)O)cc1O.
What is the InChIKey of 7-[3,3-difluoro-5-[7-(3-hydroxy-4-methylphenyl)heptyl]-2-oxopyrrolidin-1-yl]heptanoic acid?
The InChIKey is RFBWAICVSYFQHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H37F2NO4/c1-19-14-15-20(17-22(19)29)11-7-3-2-4-8-12-21-18-25(26,27)24(32)28(21)16-10-6-5-9-13-23(30)31/h14-15,17,21,29H,2-13,16,18H2,1H3,(H,30,31).
What are the key properties of 7-[3,3-difluoro-5-[7-(3-hydroxy-4-methylphenyl)heptyl]-2-oxopyrrolidin-1-yl]heptanoic acid?
7-[3,3-difluoro-5-[7-(3-hydroxy-4-methylphenyl)heptyl]-2-oxopyrrolidin-1-yl]heptanoic acid has a molecular weight of 453.57 g/mol, XLogP of 5.86, 15 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[3,3-difluoro-5-[7-(3-hydroxy-4-methylphenyl)heptyl]-2-oxopyrrolidin-1-yl]heptanoic acid is sourced from PubChem (CID 146327414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).