About 1-diethoxyphosphoryl-1,1-difluoro-4-iodobutane
1-diethoxyphosphoryl-1,1-difluoro-4-iodobutane (PubChem CID 14632758) has the molecular formula C8H16F2IO3P
and a molecular weight of 356.09 g/mol. Its IUPAC name is 1-diethoxyphosphoryl-1,1-difluoro-4-iodobutane.
Molecular Properties
| Compound Name | 1-diethoxyphosphoryl-1,1-difluoro-4-iodobutane |
| PubChem CID | 14632758 |
| Molecular Formula | C8H16F2IO3P |
| Molecular Weight | 356.09 g/mol |
| Exact Mass | 355.98 |
| IUPAC Name | 1-diethoxyphosphoryl-1,1-difluoro-4-iodobutane |
| SMILES | CCOP(=O)(OCC)C(F)(F)CCCI |
| InChI | InChI=1S/C8H16F2IO3P/c1-3-13-15(12,14-4-2)8(9,10)6-5-7-11/h3-7H2,1-2H3 |
| InChIKey | FMOGVTZLEXLRNH-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.09 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-diethoxyphosphoryl-1,1-difluoro-4-iodobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-diethoxyphosphoryl-1,1-difluoro-4-iodobutane?
The IUPAC name of 1-diethoxyphosphoryl-1,1-difluoro-4-iodobutane (CID 14632758) is 1-diethoxyphosphoryl-1,1-difluoro-4-iodobutane.
What is the SMILES notation for 1-diethoxyphosphoryl-1,1-difluoro-4-iodobutane?
The canonical SMILES for 1-diethoxyphosphoryl-1,1-difluoro-4-iodobutane is CCOP(=O)(OCC)C(F)(F)CCCI.
What is the InChIKey of 1-diethoxyphosphoryl-1,1-difluoro-4-iodobutane?
The InChIKey is FMOGVTZLEXLRNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16F2IO3P/c1-3-13-15(12,14-4-2)8(9,10)6-5-7-11/h3-7H2,1-2H3.
What are the key properties of 1-diethoxyphosphoryl-1,1-difluoro-4-iodobutane?
1-diethoxyphosphoryl-1,1-difluoro-4-iodobutane has a molecular weight of 356.09 g/mol, XLogP of 4.06, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-diethoxyphosphoryl-1,1-difluoro-4-iodobutane is sourced from PubChem (CID 14632758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).