C33H35N9O5 — CID 146327656
2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-1-[4-[4-[2-(2-methoxyethoxy)ethoxy]phenyl]piperazin-1-yl]-2-phenylethanone (PubChem CID 146327656) has the molecular formula C33H35N9O5 and a molecular weight of 637.70 g/mol. Its IUPAC name is 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-1-[4-[4-[2-(2-methoxyethoxy)ethoxy]phenyl]piperazin-1-yl]-2-phenylethanone.
| Compound Name | 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-1-[4-[4-[2-(2-methoxyethoxy)ethoxy]phenyl]piperazin-1-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 146327656 |
| Molecular Formula | C33H35N9O5 |
| Molecular Weight | 637.70 g/mol |
| Exact Mass | 637.28 |
| IUPAC Name | 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-1-[4-[4-[2-(2-methoxyethoxy)ethoxy]phenyl]piperazin-1-yl]-2-phenylethanone |
| SMILES | COCCOCCOc1ccc(N2CCN(C(=O)C(c3ccccc3)n3ncc4c3nc(N)n3nc(-c5ccco5)nc43)CC2)cc1 |
| InChI | InChI=1S/C33H35N9O5/c1-44-18-19-45-20-21-46-25-11-9-24(10-12-25)39-13-15-40(16-14-39)32(43)28(23-6-3-2-4-7-23)41-31-26(22-35-41)30-36-29(27-8-5-17-47-27)38-42(30)33(34)37-31/h2-12,17,22,28H,13-16,18-21H2,1H3,(H2,34,37) |
| InChIKey | PITDMAUACCSLPC-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 151.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.70 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|