C32H33N9O4 — CID 146327696
2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-1-[(2S)-4-[4-(2-methoxyethoxy)phenyl]-2-methylpiperazin-1-yl]-2-phenylethanone (PubChem CID 146327696) has the molecular formula C32H33N9O4 and a molecular weight of 607.68 g/mol. Its IUPAC name is 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-1-[(2S)-4-[4-(2-methoxyethoxy)phenyl]-2-methylpiperazin-1-yl]-2-phenylethanone.
| Compound Name | 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-1-[(2S)-4-[4-(2-methoxyethoxy)phenyl]-2-methylpiperazin-1-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 146327696 |
| Molecular Formula | C32H33N9O4 |
| Molecular Weight | 607.68 g/mol |
| Exact Mass | 607.27 |
| IUPAC Name | 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-1-[(2S)-4-[4-(2-methoxyethoxy)phenyl]-2-methylpiperazin-1-yl]-2-phenylethanone |
| SMILES | COCCOc1ccc(N2CCN(C(=O)C(c3ccccc3)n3ncc4c3nc(N)n3nc(-c5ccco5)nc43)[C@@H](C)C2)cc1 |
| InChI | InChI=1S/C32H33N9O4/c1-21-20-38(23-10-12-24(13-11-23)44-18-17-43-2)14-15-39(21)31(42)27(22-7-4-3-5-8-22)40-30-25(19-34-40)29-35-28(26-9-6-16-45-26)37-41(29)32(33)36-30/h3-13,16,19,21,27H,14-15,17-18,20H2,1-2H3,(H2,33,36)/t21-,27?/m0/s1 |
| InChIKey | BTFYEIOIXLTCKZ-LWAJAQLZSA-N |
| XLogP | 3.67 |
| TPSA | 142.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.68 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|