C30H38FN9O4 — CID 146327767
2-[7-amino-4-(furan-2-yl)-8-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,11-tetraen-10-yl]-1-[4-[2-fluoro-4-(2-methoxyethoxy)phenyl]piperazin-1-yl]-4-methylpentan-1-one (PubChem CID 146327767) has the molecular formula C30H38FN9O4 and a molecular weight of 607.69 g/mol. Its IUPAC name is 2-[7-amino-4-(furan-2-yl)-8-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,11-tetraen-10-yl]-1-[4-[2-fluoro-4-(2-methoxyethoxy)phenyl]piperazin-1-yl]-4-methylpentan-1-one.
| Compound Name | 2-[7-amino-4-(furan-2-yl)-8-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,11-tetraen-10-yl]-1-[4-[2-fluoro-4-(2-methoxyethoxy)phenyl]piperazin-1-yl]-4-methylpentan-1-one |
|---|---|
| PubChem CID | 146327767 |
| Molecular Formula | C30H38FN9O4 |
| Molecular Weight | 607.69 g/mol |
| Exact Mass | 607.30 |
| IUPAC Name | 2-[7-amino-4-(furan-2-yl)-8-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,11-tetraen-10-yl]-1-[4-[2-fluoro-4-(2-methoxyethoxy)phenyl]piperazin-1-yl]-4-methylpentan-1-one |
| SMILES | COCCOc1ccc(N2CCN(C(=O)C(CC(C)C)n3ncc4c3N(C)C(N)n3nc(-c5ccco5)nc3-4)CC2)c(F)c1 |
| InChI | InChI=1S/C30H38FN9O4/c1-19(2)16-24(29(41)38-11-9-37(10-12-38)23-8-7-20(17-22(23)31)43-15-14-42-4)39-28-21(18-33-39)27-34-26(25-6-5-13-44-25)35-40(27)30(32)36(28)3/h5-8,13,17-19,24,30H,9-12,14-16,32H2,1-4H3 |
| InChIKey | JPTDXDAJEQFEAP-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 132.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.69 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|