C8H5F11O2 — CID 14632790
4,4,5,5,6,6,7,7,8,8,8-undecafluorooctanoic acid (PubChem CID 14632790) has the molecular formula C8H5F11O2 and a molecular weight of 342.10 g/mol. Its IUPAC name is 4,4,5,5,6,6,7,7,8,8,8-undecafluorooctanoic acid.
| Compound Name | 4,4,5,5,6,6,7,7,8,8,8-undecafluorooctanoic acid |
|---|---|
| PubChem CID | 14632790 |
| Molecular Formula | C8H5F11O2 |
| Molecular Weight | 342.10 g/mol |
| Exact Mass | 342.01 |
| IUPAC Name | 4,4,5,5,6,6,7,7,8,8,8-undecafluorooctanoic acid |
| SMILES | O=C(O)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H5F11O2/c9-4(10,2-1-3(20)21)5(11,12)6(13,14)7(15,16)8(17,18)19/h1-2H2,(H,20,21) |
| InChIKey | ABFCFCPCGMHSRX-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.10 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|