C28H32FN9O4 — CID 146327994
2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-1-[4-[3-fluoro-4-(2-methoxyethoxy)phenyl]piperazin-1-yl]pentan-1-one (PubChem CID 146327994) has the molecular formula C28H32FN9O4 and a molecular weight of 577.62 g/mol. Its IUPAC name is 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-1-[4-[3-fluoro-4-(2-methoxyethoxy)phenyl]piperazin-1-yl]pentan-1-one.
| Compound Name | 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-1-[4-[3-fluoro-4-(2-methoxyethoxy)phenyl]piperazin-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 146327994 |
| Molecular Formula | C28H32FN9O4 |
| Molecular Weight | 577.62 g/mol |
| Exact Mass | 577.26 |
| IUPAC Name | 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-1-[4-[3-fluoro-4-(2-methoxyethoxy)phenyl]piperazin-1-yl]pentan-1-one |
| SMILES | CCCC(C(=O)N1CCN(c2ccc(OCCOC)c(F)c2)CC1)n1ncc2c1nc(N)n1nc(-c3ccco3)nc21 |
| InChI | InChI=1S/C28H32FN9O4/c1-3-5-21(27(39)36-11-9-35(10-12-36)18-7-8-22(20(29)16-18)42-15-14-40-2)37-26-19(17-31-37)25-32-24(23-6-4-13-41-23)34-38(25)28(30)33-26/h4,6-8,13,16-17,21H,3,5,9-12,14-15H2,1-2H3,(H2,30,33) |
| InChIKey | UIGLJTUYEAAMGR-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 142.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.62 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|