C33H30N10O5 — CID 146328056
2-[2-[4-[4-[2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-11-yl]propanoyl]piperazin-1-yl]phenoxy]ethyl]isoindole-1,3-dione (PubChem CID 146328056) has the molecular formula C33H30N10O5 and a molecular weight of 646.67 g/mol. Its IUPAC name is 2-[2-[4-[4-[2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-11-yl]propanoyl]piperazin-1-yl]phenoxy]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[4-[4-[2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-11-yl]propanoyl]piperazin-1-yl]phenoxy]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 146328056 |
| Molecular Formula | C33H30N10O5 |
| Molecular Weight | 646.67 g/mol |
| Exact Mass | 646.24 |
| IUPAC Name | 2-[2-[4-[4-[2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-11-yl]propanoyl]piperazin-1-yl]phenoxy]ethyl]isoindole-1,3-dione |
| SMILES | CC(C(=O)N1CCN(c2ccc(OCCN3C(=O)c4ccccc4C3=O)cc2)CC1)n1cc2c(nc(N)n3nc(-c4ccco4)nc23)n1 |
| InChI | InChI=1S/C33H30N10O5/c1-20(42-19-25-27(37-42)36-33(34)43-29(25)35-28(38-43)26-7-4-17-48-26)30(44)40-14-12-39(13-15-40)21-8-10-22(11-9-21)47-18-16-41-31(45)23-5-2-3-6-24(23)32(41)46/h2-11,17,19-20H,12-16,18H2,1H3,(H2,34,36,37) |
| InChIKey | ONEAXVBIKUPEAA-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 170.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.67 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|