C13H12Cl2FN — CID 146328602
(1E,3E,5Z)-5-(3,4-dichlorophenyl)-1-fluorohepta-1,3,5-trien-4-amine (PubChem CID 146328602) has the molecular formula C13H12Cl2FN and a molecular weight of 272.15 g/mol. Its IUPAC name is (1E,3E,5Z)-5-(3,4-dichlorophenyl)-1-fluorohepta-1,3,5-trien-4-amine.
| Compound Name | (1E,3E,5Z)-5-(3,4-dichlorophenyl)-1-fluorohepta-1,3,5-trien-4-amine |
|---|---|
| PubChem CID | 146328602 |
| Molecular Formula | C13H12Cl2FN |
| Molecular Weight | 272.15 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | (1E,3E,5Z)-5-(3,4-dichlorophenyl)-1-fluorohepta-1,3,5-trien-4-amine |
| SMILES | C/C=C(C(\N)=C/C=C/F)/c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H12Cl2FN/c1-2-10(13(17)4-3-7-16)9-5-6-11(14)12(15)8-9/h2-8H,17H2,1H3/b7-3+,10-2-,13-4+ |
| InChIKey | ABDSFCVQUASCHA-LVSCFDBMSA-N |
| XLogP | 4.72 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.15 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|