C15H28FN3 — CID 146329024
(1R)-1-N'-[1-[[(3S,6E)-7-fluorohepta-1,6-dien-3-yl]amino]ethenyl]-1-N-propan-2-ylpropane-1,1-diamine (PubChem CID 146329024) has the molecular formula C15H28FN3 and a molecular weight of 269.41 g/mol. Its IUPAC name is (1R)-1-N'-[1-[[(3S,6E)-7-fluorohepta-1,6-dien-3-yl]amino]ethenyl]-1-N-propan-2-ylpropane-1,1-diamine.
| Compound Name | (1R)-1-N'-[1-[[(3S,6E)-7-fluorohepta-1,6-dien-3-yl]amino]ethenyl]-1-N-propan-2-ylpropane-1,1-diamine |
|---|---|
| PubChem CID | 146329024 |
| Molecular Formula | C15H28FN3 |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.23 |
| IUPAC Name | (1R)-1-N'-[1-[[(3S,6E)-7-fluorohepta-1,6-dien-3-yl]amino]ethenyl]-1-N-propan-2-ylpropane-1,1-diamine |
| SMILES | C=C[C@H](CC/C=C/F)NC(=C)N[C@H](CC)NC(C)C |
| InChI | InChI=1S/C15H28FN3/c1-6-14(10-8-9-11-16)18-13(5)19-15(7-2)17-12(3)4/h6,9,11-12,14-15,17-19H,1,5,7-8,10H2,2-4H3/b11-9+/t14-,15-/m1/s1 |
| InChIKey | PXMDCUKUSWKBQH-IANUHJRKSA-N |
| XLogP | 3.19 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|