C20H20N6O4 — CID 146329334
(2R,6R)-4-(8-cyanoquinoxalin-5-yl)-N-(2,6-dioxopiperidin-3-yl)-6-methylmorpholine-2-carboxamide (PubChem CID 146329334) has the molecular formula C20H20N6O4 and a molecular weight of 408.42 g/mol. Its IUPAC name is (2R,6R)-4-(8-cyanoquinoxalin-5-yl)-N-(2,6-dioxopiperidin-3-yl)-6-methylmorpholine-2-carboxamide.
| Compound Name | (2R,6R)-4-(8-cyanoquinoxalin-5-yl)-N-(2,6-dioxopiperidin-3-yl)-6-methylmorpholine-2-carboxamide |
|---|---|
| PubChem CID | 146329334 |
| Molecular Formula | C20H20N6O4 |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | (2R,6R)-4-(8-cyanoquinoxalin-5-yl)-N-(2,6-dioxopiperidin-3-yl)-6-methylmorpholine-2-carboxamide |
| SMILES | C[C@@H]1CN(c2ccc(C#N)c3nccnc23)C[C@H](C(=O)NC2CCC(=O)NC2=O)O1 |
| InChI | InChI=1S/C20H20N6O4/c1-11-9-26(14-4-2-12(8-21)17-18(14)23-7-6-22-17)10-15(30-11)20(29)24-13-3-5-16(27)25-19(13)28/h2,4,6-7,11,13,15H,3,5,9-10H2,1H3,(H,24,29)(H,25,27,28)/t11-,13?,15-/m1/s1 |
| InChIKey | MWXHLQYKPRFFCV-IMORHIPNSA-N |
| XLogP | 0.02 |
| TPSA | 137.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|