C18H21N5OS — CID 146329572
8-[2-(azetidin-3-ylsulfanylmethyl)-6-methylmorpholin-4-yl]quinoxaline-5-carbonitrile (PubChem CID 146329572) has the molecular formula C18H21N5OS and a molecular weight of 355.47 g/mol. Its IUPAC name is 8-[2-(azetidin-3-ylsulfanylmethyl)-6-methylmorpholin-4-yl]quinoxaline-5-carbonitrile.
| Compound Name | 8-[2-(azetidin-3-ylsulfanylmethyl)-6-methylmorpholin-4-yl]quinoxaline-5-carbonitrile |
|---|---|
| PubChem CID | 146329572 |
| Molecular Formula | C18H21N5OS |
| Molecular Weight | 355.47 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 8-[2-(azetidin-3-ylsulfanylmethyl)-6-methylmorpholin-4-yl]quinoxaline-5-carbonitrile |
| SMILES | CC1CN(c2ccc(C#N)c3nccnc23)CC(CSC2CNC2)O1 |
| InChI | InChI=1S/C18H21N5OS/c1-12-9-23(10-14(24-12)11-25-15-7-20-8-15)16-3-2-13(6-19)17-18(16)22-5-4-21-17/h2-5,12,14-15,20H,7-11H2,1H3 |
| InChIKey | VCZAJALKHFWUMZ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 74.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.47 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |