About 2-methyl-6H-thieno[2,3-c]pyridine-7-thione
2-methyl-6H-thieno[2,3-c]pyridine-7-thione (PubChem CID 146330295) has the molecular formula C8H7NS2
and a molecular weight of 181.28 g/mol. Its IUPAC name is 2-methyl-6H-thieno[2,3-c]pyridine-7-thione.
Molecular Properties
| Compound Name | 2-methyl-6H-thieno[2,3-c]pyridine-7-thione |
| PubChem CID | 146330295 |
| Molecular Formula | C8H7NS2 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.00 |
| IUPAC Name | 2-methyl-6H-thieno[2,3-c]pyridine-7-thione |
| SMILES | Cc1cc2cc[nH]c(=S)c2s1 |
| InChI | InChI=1S/C8H7NS2/c1-5-4-6-2-3-9-8(10)7(6)11-5/h2-4H,1H3,(H,9,10) |
| InChIKey | FSNORWQMDIEEFV-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-6H-thieno[2,3-c]pyridine-7-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6H-thieno[2,3-c]pyridine-7-thione?
The IUPAC name of 2-methyl-6H-thieno[2,3-c]pyridine-7-thione (CID 146330295) is 2-methyl-6H-thieno[2,3-c]pyridine-7-thione.
What is the SMILES notation for 2-methyl-6H-thieno[2,3-c]pyridine-7-thione?
The canonical SMILES for 2-methyl-6H-thieno[2,3-c]pyridine-7-thione is Cc1cc2cc[nH]c(=S)c2s1.
What is the InChIKey of 2-methyl-6H-thieno[2,3-c]pyridine-7-thione?
The InChIKey is FSNORWQMDIEEFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NS2/c1-5-4-6-2-3-9-8(10)7(6)11-5/h2-4H,1H3,(H,9,10).
What are the key properties of 2-methyl-6H-thieno[2,3-c]pyridine-7-thione?
2-methyl-6H-thieno[2,3-c]pyridine-7-thione has a molecular weight of 181.28 g/mol, XLogP of 3.27, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6H-thieno[2,3-c]pyridine-7-thione is sourced from PubChem (CID 146330295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).