About 5-tert-butyl-2-(2,2-dimethylpropyl)-1,3-oxathiolane
5-tert-butyl-2-(2,2-dimethylpropyl)-1,3-oxathiolane (PubChem CID 146330311) has the molecular formula C12H24OS
and a molecular weight of 216.39 g/mol. Its IUPAC name is 5-tert-butyl-2-(2,2-dimethylpropyl)-1,3-oxathiolane.
Molecular Properties
| Compound Name | 5-tert-butyl-2-(2,2-dimethylpropyl)-1,3-oxathiolane |
| PubChem CID | 146330311 |
| Molecular Formula | C12H24OS |
| Molecular Weight | 216.39 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 5-tert-butyl-2-(2,2-dimethylpropyl)-1,3-oxathiolane |
| SMILES | CC(C)(C)CC1OC(C(C)(C)C)CS1 |
| InChI | InChI=1S/C12H24OS/c1-11(2,3)7-10-13-9(8-14-10)12(4,5)6/h9-10H,7-8H2,1-6H3 |
| InChIKey | ZMHKZQZMMQGADM-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.39 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-tert-butyl-2-(2,2-dimethylpropyl)-1,3-oxathiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-2-(2,2-dimethylpropyl)-1,3-oxathiolane?
The IUPAC name of 5-tert-butyl-2-(2,2-dimethylpropyl)-1,3-oxathiolane (CID 146330311) is 5-tert-butyl-2-(2,2-dimethylpropyl)-1,3-oxathiolane.
What is the SMILES notation for 5-tert-butyl-2-(2,2-dimethylpropyl)-1,3-oxathiolane?
The canonical SMILES for 5-tert-butyl-2-(2,2-dimethylpropyl)-1,3-oxathiolane is CC(C)(C)CC1OC(C(C)(C)C)CS1.
What is the InChIKey of 5-tert-butyl-2-(2,2-dimethylpropyl)-1,3-oxathiolane?
The InChIKey is ZMHKZQZMMQGADM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24OS/c1-11(2,3)7-10-13-9(8-14-10)12(4,5)6/h9-10H,7-8H2,1-6H3.
What are the key properties of 5-tert-butyl-2-(2,2-dimethylpropyl)-1,3-oxathiolane?
5-tert-butyl-2-(2,2-dimethylpropyl)-1,3-oxathiolane has a molecular weight of 216.39 g/mol, XLogP of 3.93, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-2-(2,2-dimethylpropyl)-1,3-oxathiolane is sourced from PubChem (CID 146330311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).