C19H19FN4O2 — CID 146330529
1-[7-[6-(2-fluoro-6-hydroxyphenyl)pyrimidin-4-yl]-2,7-diazaspiro[3.4]octan-2-yl]prop-2-en-1-one (PubChem CID 146330529) has the molecular formula C19H19FN4O2 and a molecular weight of 354.39 g/mol. Its IUPAC name is 1-[7-[6-(2-fluoro-6-hydroxyphenyl)pyrimidin-4-yl]-2,7-diazaspiro[3.4]octan-2-yl]prop-2-en-1-one.
| Compound Name | 1-[7-[6-(2-fluoro-6-hydroxyphenyl)pyrimidin-4-yl]-2,7-diazaspiro[3.4]octan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 146330529 |
| Molecular Formula | C19H19FN4O2 |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 1-[7-[6-(2-fluoro-6-hydroxyphenyl)pyrimidin-4-yl]-2,7-diazaspiro[3.4]octan-2-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC2(CCN(c3cc(-c4c(O)cccc4F)ncn3)C2)C1 |
| InChI | InChI=1S/C19H19FN4O2/c1-2-17(26)24-10-19(11-24)6-7-23(9-19)16-8-14(21-12-22-16)18-13(20)4-3-5-15(18)25/h2-5,8,12,25H,1,6-7,9-11H2 |
| InChIKey | RVYIAAZSDQDZEN-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|