C24H38O6 — CID 14633066
4-[[(1R,2R,3S,4aR,8aR)-3-hydroxy-1-[(E)-5-hydroxy-3-methylpent-3-enyl]-1,4a,5-trimethyl-2,3,4,7,8,8a-hexahydronaphthalen-2-yl]methoxy]-4-oxobutanoic acid (PubChem CID 14633066) has the molecular formula C24H38O6 and a molecular weight of 422.56 g/mol. Its IUPAC name is 4-[[(1R,2R,3S,4aR,8aR)-3-hydroxy-1-[(E)-5-hydroxy-3-methylpent-3-enyl]-1,4a,5-trimethyl-2,3,4,7,8,8a-hexahydronaphthalen-2-yl]methoxy]-4-oxobutanoic acid.
| Compound Name | 4-[[(1R,2R,3S,4aR,8aR)-3-hydroxy-1-[(E)-5-hydroxy-3-methylpent-3-enyl]-1,4a,5-trimethyl-2,3,4,7,8,8a-hexahydronaphthalen-2-yl]methoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 14633066 |
| Molecular Formula | C24H38O6 |
| Molecular Weight | 422.56 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | 4-[[(1R,2R,3S,4aR,8aR)-3-hydroxy-1-[(E)-5-hydroxy-3-methylpent-3-enyl]-1,4a,5-trimethyl-2,3,4,7,8,8a-hexahydronaphthalen-2-yl]methoxy]-4-oxobutanoic acid |
| SMILES | CC1=CCC[C@@H]2[C@@](C)(CC/C(C)=C/CO)[C@H](COC(=O)CCC(=O)O)[C@@H](O)C[C@@]12C |
| InChI | InChI=1S/C24H38O6/c1-16(11-13-25)10-12-23(3)18(15-30-22(29)9-8-21(27)28)19(26)14-24(4)17(2)6-5-7-20(23)24/h6,11,18-20,25-26H,5,7-10,12-15H2,1-4H3,(H,27,28)/b16-11+/t18-,19+,20-,23+,24+/m1/s1 |
| InChIKey | JDKUSIUPEUOZEW-MUFKJQONSA-N |
| XLogP | 3.86 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.56 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|