C11H12Cl3N3 — CID 146330797
2,6-dichloro-7-(1-chloro-2-methylprop-1-enyl)-5-methyl-6,7-dihydropyrrolo[3,2-d]pyrimidine (PubChem CID 146330797) has the molecular formula C11H12Cl3N3 and a molecular weight of 292.60 g/mol. Its IUPAC name is 2,6-dichloro-7-(1-chloro-2-methylprop-1-enyl)-5-methyl-6,7-dihydropyrrolo[3,2-d]pyrimidine.
| Compound Name | 2,6-dichloro-7-(1-chloro-2-methylprop-1-enyl)-5-methyl-6,7-dihydropyrrolo[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 146330797 |
| Molecular Formula | C11H12Cl3N3 |
| Molecular Weight | 292.60 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | 2,6-dichloro-7-(1-chloro-2-methylprop-1-enyl)-5-methyl-6,7-dihydropyrrolo[3,2-d]pyrimidine |
| SMILES | CC(C)=C(Cl)C1c2nc(Cl)ncc2N(C)C1Cl |
| InChI | InChI=1S/C11H12Cl3N3/c1-5(2)8(12)7-9-6(17(3)10(7)13)4-15-11(14)16-9/h4,7,10H,1-3H3 |
| InChIKey | IWTKZFKTFOHTBJ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.60 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|