C14H22F4NP — CID 146330895
1-(3,3,4,5-tetrafluoro-1,2,3a,4,5,6,7,7a-octahydroinden-2-yl)phosphinan-4-amine (PubChem CID 146330895) has the molecular formula C14H22F4NP and a molecular weight of 311.30 g/mol. Its IUPAC name is 1-(3,3,4,5-tetrafluoro-1,2,3a,4,5,6,7,7a-octahydroinden-2-yl)phosphinan-4-amine.
| Compound Name | 1-(3,3,4,5-tetrafluoro-1,2,3a,4,5,6,7,7a-octahydroinden-2-yl)phosphinan-4-amine |
|---|---|
| PubChem CID | 146330895 |
| Molecular Formula | C14H22F4NP |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 1-(3,3,4,5-tetrafluoro-1,2,3a,4,5,6,7,7a-octahydroinden-2-yl)phosphinan-4-amine |
| SMILES | NC1CCP(C2CC3CCC(F)C(F)C3C2(F)F)CC1 |
| InChI | InChI=1S/C14H22F4NP/c15-10-2-1-8-7-11(14(17,18)12(8)13(10)16)20-5-3-9(19)4-6-20/h8-13H,1-7,19H2 |
| InChIKey | NATRYJJWMPLFGU-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|