C11H10N2O2S — CID 146331533
ethyl 2-(1,3-thiazol-4-yl)pyridine-3-carboxylate (PubChem CID 146331533) has the molecular formula C11H10N2O2S and a molecular weight of 234.28 g/mol. Its IUPAC name is ethyl 2-(1,3-thiazol-4-yl)pyridine-3-carboxylate.
| Compound Name | ethyl 2-(1,3-thiazol-4-yl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 146331533 |
| Molecular Formula | C11H10N2O2S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | ethyl 2-(1,3-thiazol-4-yl)pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cccnc1-c1cscn1 |
| InChI | InChI=1S/C11H10N2O2S/c1-2-15-11(14)8-4-3-5-12-10(8)9-6-16-7-13-9/h3-7H,2H2,1H3 |
| InChIKey | MGMHOHQZIJJFCQ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |