C31H41N5O4 — CID 146332127
(4S,7S,9aR)-N-benzhydryl-4-[[(2S)-2-(methylamino)propanoyl]amino]-2-(3-methylbutanoyl)-5-oxo-3,4,7,8,9,9a-hexahydro-1H-pyrrolo[1,2-a][1,4]diazepine-7-carboxamide (PubChem CID 146332127) has the molecular formula C31H41N5O4 and a molecular weight of 547.70 g/mol. Its IUPAC name is (4S,7S,9aR)-N-benzhydryl-4-[[(2S)-2-(methylamino)propanoyl]amino]-2-(3-methylbutanoyl)-5-oxo-3,4,7,8,9,9a-hexahydro-1H-pyrrolo[1,2-a][1,4]diazepine-7-carboxamide.
| Compound Name | (4S,7S,9aR)-N-benzhydryl-4-[[(2S)-2-(methylamino)propanoyl]amino]-2-(3-methylbutanoyl)-5-oxo-3,4,7,8,9,9a-hexahydro-1H-pyrrolo[1,2-a][1,4]diazepine-7-carboxamide |
|---|---|
| PubChem CID | 146332127 |
| Molecular Formula | C31H41N5O4 |
| Molecular Weight | 547.70 g/mol |
| Exact Mass | 547.32 |
| IUPAC Name | (4S,7S,9aR)-N-benzhydryl-4-[[(2S)-2-(methylamino)propanoyl]amino]-2-(3-methylbutanoyl)-5-oxo-3,4,7,8,9,9a-hexahydro-1H-pyrrolo[1,2-a][1,4]diazepine-7-carboxamide |
| SMILES | CN[C@@H](C)C(=O)N[C@H]1CN(C(=O)CC(C)C)C[C@H]2CC[C@@H](C(=O)NC(c3ccccc3)c3ccccc3)N2C1=O |
| InChI | InChI=1S/C31H41N5O4/c1-20(2)17-27(37)35-18-24-15-16-26(36(24)31(40)25(19-35)33-29(38)21(3)32-4)30(39)34-28(22-11-7-5-8-12-22)23-13-9-6-10-14-23/h5-14,20-21,24-26,28,32H,15-19H2,1-4H3,(H,33,38)(H,34,39)/t21-,24+,25-,26-/m0/s1 |
| InChIKey | PQRYQGKUVOPESU-QUKDMSEQSA-N |
| XLogP | 2.23 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.70 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |