About [(E)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylprop-2-enyl] acetate
[(E)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylprop-2-enyl] acetate (PubChem CID 14633252) has the molecular formula C11H18O4
and a molecular weight of 214.26 g/mol. Its IUPAC name is [(E)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylprop-2-enyl] acetate.
Molecular Properties
| Compound Name | [(E)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylprop-2-enyl] acetate |
| PubChem CID | 14633252 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | [(E)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylprop-2-enyl] acetate |
| SMILES | CC(=O)OC/C(C)=C/[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C11H18O4/c1-8(6-13-9(2)12)5-10-7-14-11(3,4)15-10/h5,10H,6-7H2,1-4H3/b8-5+/t10-/m0/s1 |
| InChIKey | WSKNVQNQHZBNNC-YVFTVSHDSA-N |
| XLogP | 1.65 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(E)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylprop-2-enyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylprop-2-enyl] acetate?
The IUPAC name of [(E)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylprop-2-enyl] acetate (CID 14633252) is [(E)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylprop-2-enyl] acetate.
What is the SMILES notation for [(E)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylprop-2-enyl] acetate?
The canonical SMILES for [(E)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylprop-2-enyl] acetate is CC(=O)OC/C(C)=C/[C@H]1COC(C)(C)O1.
What is the InChIKey of [(E)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylprop-2-enyl] acetate?
The InChIKey is WSKNVQNQHZBNNC-YVFTVSHDSA-N. The full InChI is InChI=1S/C11H18O4/c1-8(6-13-9(2)12)5-10-7-14-11(3,4)15-10/h5,10H,6-7H2,1-4H3/b8-5+/t10-/m0/s1.
What are the key properties of [(E)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylprop-2-enyl] acetate?
[(E)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylprop-2-enyl] acetate has a molecular weight of 214.26 g/mol, XLogP of 1.65, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylprop-2-enyl] acetate is sourced from PubChem (CID 14633252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).