C28H46N2 — CID 146332937
2-tert-butyl-4-[1-[(3,5-ditert-butylcyclohexa-1,5-dien-1-yl)amino]-2-methylpropan-2-yl]aniline (PubChem CID 146332937) has the molecular formula C28H46N2 and a molecular weight of 410.69 g/mol. Its IUPAC name is 2-tert-butyl-4-[1-[(3,5-ditert-butylcyclohexa-1,5-dien-1-yl)amino]-2-methylpropan-2-yl]aniline.
| Compound Name | 2-tert-butyl-4-[1-[(3,5-ditert-butylcyclohexa-1,5-dien-1-yl)amino]-2-methylpropan-2-yl]aniline |
|---|---|
| PubChem CID | 146332937 |
| Molecular Formula | C28H46N2 |
| Molecular Weight | 410.69 g/mol |
| Exact Mass | 410.37 |
| IUPAC Name | 2-tert-butyl-4-[1-[(3,5-ditert-butylcyclohexa-1,5-dien-1-yl)amino]-2-methylpropan-2-yl]aniline |
| SMILES | CC(C)(C)C1=CC(NCC(C)(C)c2ccc(N)c(C(C)(C)C)c2)=CC(C(C)(C)C)C1 |
| InChI | InChI=1S/C28H46N2/c1-25(2,3)20-14-21(26(4,5)6)16-22(15-20)30-18-28(10,11)19-12-13-24(29)23(17-19)27(7,8)9/h12-13,15-17,20,30H,14,18,29H2,1-11H3 |
| InChIKey | BHBBQTCWYIQPLE-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.69 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|