About 6-hydroxy-2-thieno[3,2-c]pyridin-6-yl-3H-quinazolin-4-one
6-hydroxy-2-thieno[3,2-c]pyridin-6-yl-3H-quinazolin-4-one (PubChem CID 146333407) has the molecular formula C15H9N3O2S
and a molecular weight of 295.32 g/mol. Its IUPAC name is 6-hydroxy-2-thieno[3,2-c]pyridin-6-yl-3H-quinazolin-4-one.
Molecular Properties
| Compound Name | 6-hydroxy-2-thieno[3,2-c]pyridin-6-yl-3H-quinazolin-4-one |
| PubChem CID | 146333407 |
| Molecular Formula | C15H9N3O2S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 6-hydroxy-2-thieno[3,2-c]pyridin-6-yl-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(-c2cc3sccc3cn2)nc2ccc(O)cc12 |
| InChI | InChI=1S/C15H9N3O2S/c19-9-1-2-11-10(5-9)15(20)18-14(17-11)12-6-13-8(7-16-12)3-4-21-13/h1-7,19H,(H,17,18,20) |
| InChIKey | AHFVQBBIWCXVTD-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-hydroxy-2-thieno[3,2-c]pyridin-6-yl-3H-quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-2-thieno[3,2-c]pyridin-6-yl-3H-quinazolin-4-one?
The IUPAC name of 6-hydroxy-2-thieno[3,2-c]pyridin-6-yl-3H-quinazolin-4-one (CID 146333407) is 6-hydroxy-2-thieno[3,2-c]pyridin-6-yl-3H-quinazolin-4-one.
What is the SMILES notation for 6-hydroxy-2-thieno[3,2-c]pyridin-6-yl-3H-quinazolin-4-one?
The canonical SMILES for 6-hydroxy-2-thieno[3,2-c]pyridin-6-yl-3H-quinazolin-4-one is O=c1[nH]c(-c2cc3sccc3cn2)nc2ccc(O)cc12.
What is the InChIKey of 6-hydroxy-2-thieno[3,2-c]pyridin-6-yl-3H-quinazolin-4-one?
The InChIKey is AHFVQBBIWCXVTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9N3O2S/c19-9-1-2-11-10(5-9)15(20)18-14(17-11)12-6-13-8(7-16-12)3-4-21-13/h1-7,19H,(H,17,18,20).
What are the key properties of 6-hydroxy-2-thieno[3,2-c]pyridin-6-yl-3H-quinazolin-4-one?
6-hydroxy-2-thieno[3,2-c]pyridin-6-yl-3H-quinazolin-4-one has a molecular weight of 295.32 g/mol, XLogP of 2.91, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-2-thieno[3,2-c]pyridin-6-yl-3H-quinazolin-4-one is sourced from PubChem (CID 146333407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).