C23H19F2N5O — CID 146333873
3,3-difluoro-5-phenyl-7-[2-(2H-tetrazol-5-yl)phenyl]-4,5-dihydro-2H-1-benzoxepin-9-amine (PubChem CID 146333873) has the molecular formula C23H19F2N5O and a molecular weight of 419.44 g/mol. Its IUPAC name is 3,3-difluoro-5-phenyl-7-[2-(2H-tetrazol-5-yl)phenyl]-4,5-dihydro-2H-1-benzoxepin-9-amine.
| Compound Name | 3,3-difluoro-5-phenyl-7-[2-(2H-tetrazol-5-yl)phenyl]-4,5-dihydro-2H-1-benzoxepin-9-amine |
|---|---|
| PubChem CID | 146333873 |
| Molecular Formula | C23H19F2N5O |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 3,3-difluoro-5-phenyl-7-[2-(2H-tetrazol-5-yl)phenyl]-4,5-dihydro-2H-1-benzoxepin-9-amine |
| SMILES | Nc1cc(-c2ccccc2-c2nn[nH]n2)cc2c1OCC(F)(F)CC2c1ccccc1 |
| InChI | InChI=1S/C23H19F2N5O/c24-23(25)12-19(14-6-2-1-3-7-14)18-10-15(11-20(26)21(18)31-13-23)16-8-4-5-9-17(16)22-27-29-30-28-22/h1-11,19H,12-13,26H2,(H,27,28,29,30) |
| InChIKey | NAWVKKBGLKGNLY-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|