C21H24N2O4 — CID 146334645
(9S)-9-[4-(dimethylamino)-2-ethoxyphenyl]-3,6,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]quinolin-7-one (PubChem CID 146334645) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is (9S)-9-[4-(dimethylamino)-2-ethoxyphenyl]-3,6,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]quinolin-7-one.
| Compound Name | (9S)-9-[4-(dimethylamino)-2-ethoxyphenyl]-3,6,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]quinolin-7-one |
|---|---|
| PubChem CID | 146334645 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | (9S)-9-[4-(dimethylamino)-2-ethoxyphenyl]-3,6,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]quinolin-7-one |
| SMILES | CCOc1cc(N(C)C)ccc1[C@H]1CC(=O)Nc2cc3c(cc21)OCCO3 |
| InChI | InChI=1S/C21H24N2O4/c1-4-25-18-9-13(23(2)3)5-6-14(18)15-11-21(24)22-17-12-20-19(10-16(15)17)26-7-8-27-20/h5-6,9-10,12,15H,4,7-8,11H2,1-3H3,(H,22,24)/t15-/m1/s1 |
| InChIKey | KNKVPXQGRIRJEY-OAHLLOKOSA-N |
| XLogP | 3.40 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |