About dimethyl 2-methyl-2-[(2-methyl-1,3-dioxolan-2-yl)methyl]butanedioate
dimethyl 2-methyl-2-[(2-methyl-1,3-dioxolan-2-yl)methyl]butanedioate (PubChem CID 14633515) has the molecular formula C12H20O6
and a molecular weight of 260.29 g/mol. Its IUPAC name is dimethyl 2-methyl-2-[(2-methyl-1,3-dioxolan-2-yl)methyl]butanedioate.
Molecular Properties
| Compound Name | dimethyl 2-methyl-2-[(2-methyl-1,3-dioxolan-2-yl)methyl]butanedioate |
| PubChem CID | 14633515 |
| Molecular Formula | C12H20O6 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | dimethyl 2-methyl-2-[(2-methyl-1,3-dioxolan-2-yl)methyl]butanedioate |
| SMILES | COC(=O)CC(C)(CC1(C)OCCO1)C(=O)OC |
| InChI | InChI=1S/C12H20O6/c1-11(10(14)16-4,7-9(13)15-3)8-12(2)17-5-6-18-12/h5-8H2,1-4H3 |
| InChIKey | MHRIPFVWYQGQGJ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze dimethyl 2-methyl-2-[(2-methyl-1,3-dioxolan-2-yl)methyl]butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2-methyl-2-[(2-methyl-1,3-dioxolan-2-yl)methyl]butanedioate?
The IUPAC name of dimethyl 2-methyl-2-[(2-methyl-1,3-dioxolan-2-yl)methyl]butanedioate (CID 14633515) is dimethyl 2-methyl-2-[(2-methyl-1,3-dioxolan-2-yl)methyl]butanedioate.
What is the SMILES notation for dimethyl 2-methyl-2-[(2-methyl-1,3-dioxolan-2-yl)methyl]butanedioate?
The canonical SMILES for dimethyl 2-methyl-2-[(2-methyl-1,3-dioxolan-2-yl)methyl]butanedioate is COC(=O)CC(C)(CC1(C)OCCO1)C(=O)OC.
What is the InChIKey of dimethyl 2-methyl-2-[(2-methyl-1,3-dioxolan-2-yl)methyl]butanedioate?
The InChIKey is MHRIPFVWYQGQGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O6/c1-11(10(14)16-4,7-9(13)15-3)8-12(2)17-5-6-18-12/h5-8H2,1-4H3.
What are the key properties of dimethyl 2-methyl-2-[(2-methyl-1,3-dioxolan-2-yl)methyl]butanedioate?
dimethyl 2-methyl-2-[(2-methyl-1,3-dioxolan-2-yl)methyl]butanedioate has a molecular weight of 260.29 g/mol, XLogP of 0.88, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2-methyl-2-[(2-methyl-1,3-dioxolan-2-yl)methyl]butanedioate is sourced from PubChem (CID 14633515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).