C28H14F6N2OS — CID 146335359
2-[2-[6-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-3-pyridinyl]ethynyl]-6-methyl-1,3-benzothiazole (PubChem CID 146335359) has the molecular formula C28H14F6N2OS and a molecular weight of 540.49 g/mol. Its IUPAC name is 2-[2-[6-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-3-pyridinyl]ethynyl]-6-methyl-1,3-benzothiazole.
| Compound Name | 2-[2-[6-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-3-pyridinyl]ethynyl]-6-methyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 146335359 |
| Molecular Formula | C28H14F6N2OS |
| Molecular Weight | 540.49 g/mol |
| Exact Mass | 540.07 |
| IUPAC Name | 2-[2-[6-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-3-pyridinyl]ethynyl]-6-methyl-1,3-benzothiazole |
| SMILES | Cc1ccc2nc(C#Cc3ccc(C(F)(F)Oc4ccc(-c5cc(F)c(F)c(F)c5)c(F)c4)nc3)sc2c1 |
| InChI | InChI=1S/C28H14F6N2OS/c1-15-2-7-23-24(10-15)38-26(36-23)9-4-16-3-8-25(35-14-16)28(33,34)37-18-5-6-19(20(29)13-18)17-11-21(30)27(32)22(31)12-17/h2-3,5-8,10-14H,1H3 |
| InChIKey | HZQYPAGVISQYCM-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.49 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|