C26H14F6N2OS — CID 146335361
2-[6-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-3-pyridinyl]-6-methyl-1,3-benzothiazole (PubChem CID 146335361) has the molecular formula C26H14F6N2OS and a molecular weight of 516.47 g/mol. Its IUPAC name is 2-[6-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-3-pyridinyl]-6-methyl-1,3-benzothiazole.
| Compound Name | 2-[6-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-3-pyridinyl]-6-methyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 146335361 |
| Molecular Formula | C26H14F6N2OS |
| Molecular Weight | 516.47 g/mol |
| Exact Mass | 516.07 |
| IUPAC Name | 2-[6-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-3-pyridinyl]-6-methyl-1,3-benzothiazole |
| SMILES | Cc1ccc2nc(-c3ccc(C(F)(F)Oc4ccc(-c5cc(F)c(F)c(F)c5)c(F)c4)nc3)sc2c1 |
| InChI | InChI=1S/C26H14F6N2OS/c1-13-2-6-21-22(8-13)36-25(34-21)14-3-7-23(33-12-14)26(31,32)35-16-4-5-17(18(27)11-16)15-9-19(28)24(30)20(29)10-15/h2-12H,1H3 |
| InChIKey | ZHTKQUSRWLKCOH-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.47 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|