C31H17F6NOS — CID 146335526
6-[difluoro-[2-fluoro-4-(6-methylnaphthalen-2-yl)phenyl]methoxy]-2-(3,4,5-trifluorophenyl)-1,3-benzothiazole (PubChem CID 146335526) has the molecular formula C31H17F6NOS and a molecular weight of 565.54 g/mol. Its IUPAC name is 6-[difluoro-[2-fluoro-4-(6-methylnaphthalen-2-yl)phenyl]methoxy]-2-(3,4,5-trifluorophenyl)-1,3-benzothiazole.
| Compound Name | 6-[difluoro-[2-fluoro-4-(6-methylnaphthalen-2-yl)phenyl]methoxy]-2-(3,4,5-trifluorophenyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 146335526 |
| Molecular Formula | C31H17F6NOS |
| Molecular Weight | 565.54 g/mol |
| Exact Mass | 565.09 |
| IUPAC Name | 6-[difluoro-[2-fluoro-4-(6-methylnaphthalen-2-yl)phenyl]methoxy]-2-(3,4,5-trifluorophenyl)-1,3-benzothiazole |
| SMILES | Cc1ccc2cc(-c3ccc(C(F)(F)Oc4ccc5nc(-c6cc(F)c(F)c(F)c6)sc5c4)c(F)c3)ccc2c1 |
| InChI | InChI=1S/C31H17F6NOS/c1-16-2-3-18-11-19(5-4-17(18)10-16)20-6-8-23(24(32)12-20)31(36,37)39-22-7-9-27-28(15-22)40-30(38-27)21-13-25(33)29(35)26(34)14-21/h2-15H,1H3 |
| InChIKey | PRPULJRNDQUFHW-UHFFFAOYSA-N |
| XLogP | 9.78 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.54 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|