C30H26F5NO2S — CID 146335529
2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-6-[6-(5-methyloxan-2-yl)-5,6,7,8-tetrahydronaphthalen-2-yl]-1,3-benzothiazole (PubChem CID 146335529) has the molecular formula C30H26F5NO2S and a molecular weight of 559.60 g/mol. Its IUPAC name is 2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-6-[6-(5-methyloxan-2-yl)-5,6,7,8-tetrahydronaphthalen-2-yl]-1,3-benzothiazole.
| Compound Name | 2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-6-[6-(5-methyloxan-2-yl)-5,6,7,8-tetrahydronaphthalen-2-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 146335529 |
| Molecular Formula | C30H26F5NO2S |
| Molecular Weight | 559.60 g/mol |
| Exact Mass | 559.16 |
| IUPAC Name | 2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-6-[6-(5-methyloxan-2-yl)-5,6,7,8-tetrahydronaphthalen-2-yl]-1,3-benzothiazole |
| SMILES | CC1CCC(C2CCc3cc(-c4ccc5nc(C(F)(F)Oc6cc(F)c(F)c(F)c6)sc5c4)ccc3C2)OC1 |
| InChI | InChI=1S/C30H26F5NO2S/c1-16-2-9-26(37-15-16)21-6-5-17-10-18(3-4-19(17)11-21)20-7-8-25-27(12-20)39-29(36-25)30(34,35)38-22-13-23(31)28(33)24(32)14-22/h3-4,7-8,10,12-14,16,21,26H,2,5-6,9,11,15H2,1H3 |
| InChIKey | PKXBLLNIBDFHOO-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.60 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|