C36H35BrN2O5 — CID 146335591
2-bromo-3-[[(2E,6E)-8-[7-(1-hydroxyhex-4-yn-2-ylamino)-5,8-dioxonaphthalen-2-yl]-3,7-dimethylocta-2,6-dienyl]amino]naphthalene-1,4-dione (PubChem CID 146335591) has the molecular formula C36H35BrN2O5 and a molecular weight of 655.59 g/mol. Its IUPAC name is 2-bromo-3-[[(2E,6E)-8-[7-(1-hydroxyhex-4-yn-2-ylamino)-5,8-dioxonaphthalen-2-yl]-3,7-dimethylocta-2,6-dienyl]amino]naphthalene-1,4-dione.
| Compound Name | 2-bromo-3-[[(2E,6E)-8-[7-(1-hydroxyhex-4-yn-2-ylamino)-5,8-dioxonaphthalen-2-yl]-3,7-dimethylocta-2,6-dienyl]amino]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 146335591 |
| Molecular Formula | C36H35BrN2O5 |
| Molecular Weight | 655.59 g/mol |
| Exact Mass | 654.17 |
| IUPAC Name | 2-bromo-3-[[(2E,6E)-8-[7-(1-hydroxyhex-4-yn-2-ylamino)-5,8-dioxonaphthalen-2-yl]-3,7-dimethylocta-2,6-dienyl]amino]naphthalene-1,4-dione |
| SMILES | CC#CCC(CO)NC1=CC(=O)c2ccc(C/C(C)=C/CC/C(C)=C/CNC3=C(Br)C(=O)c4ccccc4C3=O)cc2C1=O |
| InChI | InChI=1S/C36H35BrN2O5/c1-4-5-11-25(21-40)39-30-20-31(41)26-15-14-24(19-29(26)34(30)42)18-23(3)10-8-9-22(2)16-17-38-33-32(37)35(43)27-12-6-7-13-28(27)36(33)44/h6-7,10,12-16,19-20,25,38-40H,8-9,11,17-18,21H2,1-3H3/b22-16+,23-10+ |
| InChIKey | XWFYSVHHCGMHOK-BGFVVBSLSA-N |
| XLogP | 5.80 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.59 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|