About methyl (2R)-2-hydroxy-2-[(2R,5S)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]acetate
methyl (2R)-2-hydroxy-2-[(2R,5S)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]acetate (PubChem CID 14633631) has the molecular formula C11H20O5
and a molecular weight of 232.28 g/mol. Its IUPAC name is methyl (2R)-2-hydroxy-2-[(2R,5S)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]acetate.
Molecular Properties
| Compound Name | methyl (2R)-2-hydroxy-2-[(2R,5S)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]acetate |
| PubChem CID | 14633631 |
| Molecular Formula | C11H20O5 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | methyl (2R)-2-hydroxy-2-[(2R,5S)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]acetate |
| SMILES | COC(=O)[C@H](O)[C@@]1(C)CC[C@@H](C(C)(C)O)O1 |
| InChI | InChI=1S/C11H20O5/c1-10(2,14)7-5-6-11(3,16-7)8(12)9(13)15-4/h7-8,12,14H,5-6H2,1-4H3/t7-,8-,11+/m0/s1 |
| InChIKey | RRUCVFARIMURSI-DKCNOQQISA-N |
| XLogP | 0.23 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl (2R)-2-hydroxy-2-[(2R,5S)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2R)-2-hydroxy-2-[(2R,5S)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]acetate?
The IUPAC name of methyl (2R)-2-hydroxy-2-[(2R,5S)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]acetate (CID 14633631) is methyl (2R)-2-hydroxy-2-[(2R,5S)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]acetate.
What is the SMILES notation for methyl (2R)-2-hydroxy-2-[(2R,5S)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]acetate?
The canonical SMILES for methyl (2R)-2-hydroxy-2-[(2R,5S)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]acetate is COC(=O)[C@H](O)[C@@]1(C)CC[C@@H](C(C)(C)O)O1.
What is the InChIKey of methyl (2R)-2-hydroxy-2-[(2R,5S)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]acetate?
The InChIKey is RRUCVFARIMURSI-DKCNOQQISA-N. The full InChI is InChI=1S/C11H20O5/c1-10(2,14)7-5-6-11(3,16-7)8(12)9(13)15-4/h7-8,12,14H,5-6H2,1-4H3/t7-,8-,11+/m0/s1.
What are the key properties of methyl (2R)-2-hydroxy-2-[(2R,5S)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]acetate?
methyl (2R)-2-hydroxy-2-[(2R,5S)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]acetate has a molecular weight of 232.28 g/mol, XLogP of 0.23, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-2-hydroxy-2-[(2R,5S)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]acetate is sourced from PubChem (CID 14633631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).