About 1-N'-[(3E)-4-methoxyhexa-1,3-dien-2-yl]ethane-1,1-diamine
1-N'-[(3E)-4-methoxyhexa-1,3-dien-2-yl]ethane-1,1-diamine (PubChem CID 146336569) has the molecular formula C9H18N2O
and a molecular weight of 170.26 g/mol. Its IUPAC name is 1-N'-[(3E)-4-methoxyhexa-1,3-dien-2-yl]ethane-1,1-diamine.
Molecular Properties
| Compound Name | 1-N'-[(3E)-4-methoxyhexa-1,3-dien-2-yl]ethane-1,1-diamine |
| PubChem CID | 146336569 |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | 1-N'-[(3E)-4-methoxyhexa-1,3-dien-2-yl]ethane-1,1-diamine |
| SMILES | C=C(/C=C(\CC)OC)NC(C)N |
| InChI | InChI=1S/C9H18N2O/c1-5-9(12-4)6-7(2)11-8(3)10/h6,8,11H,2,5,10H2,1,3-4H3/b9-6+ |
| InChIKey | RXKAJZMKCYRMSX-RMKNXTFCSA-N |
| XLogP | 1.33 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-N'-[(3E)-4-methoxyhexa-1,3-dien-2-yl]ethane-1,1-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N'-[(3E)-4-methoxyhexa-1,3-dien-2-yl]ethane-1,1-diamine?
The IUPAC name of 1-N'-[(3E)-4-methoxyhexa-1,3-dien-2-yl]ethane-1,1-diamine (CID 146336569) is 1-N'-[(3E)-4-methoxyhexa-1,3-dien-2-yl]ethane-1,1-diamine.
What is the SMILES notation for 1-N'-[(3E)-4-methoxyhexa-1,3-dien-2-yl]ethane-1,1-diamine?
The canonical SMILES for 1-N'-[(3E)-4-methoxyhexa-1,3-dien-2-yl]ethane-1,1-diamine is C=C(/C=C(\CC)OC)NC(C)N.
What is the InChIKey of 1-N'-[(3E)-4-methoxyhexa-1,3-dien-2-yl]ethane-1,1-diamine?
The InChIKey is RXKAJZMKCYRMSX-RMKNXTFCSA-N. The full InChI is InChI=1S/C9H18N2O/c1-5-9(12-4)6-7(2)11-8(3)10/h6,8,11H,2,5,10H2,1,3-4H3/b9-6+.
What are the key properties of 1-N'-[(3E)-4-methoxyhexa-1,3-dien-2-yl]ethane-1,1-diamine?
1-N'-[(3E)-4-methoxyhexa-1,3-dien-2-yl]ethane-1,1-diamine has a molecular weight of 170.26 g/mol, XLogP of 1.33, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N'-[(3E)-4-methoxyhexa-1,3-dien-2-yl]ethane-1,1-diamine is sourced from PubChem (CID 146336569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).