C11H7F17 — CID 146336629
1,1,1,2,4,5,5,5-octafluoro-3-(1,1,1,3,3,3-hexafluoropropan-2-yl)-2,3-dimethyl-4-(trifluoromethyl)pentane (PubChem CID 146336629) has the molecular formula C11H7F17 and a molecular weight of 462.14 g/mol. Its IUPAC name is 1,1,1,2,4,5,5,5-octafluoro-3-(1,1,1,3,3,3-hexafluoropropan-2-yl)-2,3-dimethyl-4-(trifluoromethyl)pentane.
| Compound Name | 1,1,1,2,4,5,5,5-octafluoro-3-(1,1,1,3,3,3-hexafluoropropan-2-yl)-2,3-dimethyl-4-(trifluoromethyl)pentane |
|---|---|
| PubChem CID | 146336629 |
| Molecular Formula | C11H7F17 |
| Molecular Weight | 462.14 g/mol |
| Exact Mass | 462.03 |
| IUPAC Name | 1,1,1,2,4,5,5,5-octafluoro-3-(1,1,1,3,3,3-hexafluoropropan-2-yl)-2,3-dimethyl-4-(trifluoromethyl)pentane |
| SMILES | CC(F)(C(F)(F)F)C(C)(C(C(F)(F)F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H7F17/c1-4(5(2,12)9(20,21)22,3(6(13,14)15)7(16,17)18)8(19,10(23,24)25)11(26,27)28/h3H,1-2H3 |
| InChIKey | CAOBGWZSARHIRD-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.14 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |