About (7Z,9Z)-5-ethyl-2-iodo-N-methylundeca-7,9-dien-1-amine
(7Z,9Z)-5-ethyl-2-iodo-N-methylundeca-7,9-dien-1-amine (PubChem CID 146336875) has the molecular formula C14H26IN
and a molecular weight of 335.27 g/mol. Its IUPAC name is (7Z,9Z)-5-ethyl-2-iodo-N-methylundeca-7,9-dien-1-amine.
Molecular Properties
| Compound Name | (7Z,9Z)-5-ethyl-2-iodo-N-methylundeca-7,9-dien-1-amine |
| PubChem CID | 146336875 |
| Molecular Formula | C14H26IN |
| Molecular Weight | 335.27 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | (7Z,9Z)-5-ethyl-2-iodo-N-methylundeca-7,9-dien-1-amine |
| SMILES | C/C=C\C=C/CC(CC)CCC(I)CNC |
| InChI | InChI=1S/C14H26IN/c1-4-6-7-8-9-13(5-2)10-11-14(15)12-16-3/h4,6-8,13-14,16H,5,9-12H2,1-3H3/b6-4-,8-7- |
| InChIKey | CSWPIOUWZKVGHG-MOIRPGTBSA-N |
| XLogP | 4.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.27 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (7Z,9Z)-5-ethyl-2-iodo-N-methylundeca-7,9-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7Z,9Z)-5-ethyl-2-iodo-N-methylundeca-7,9-dien-1-amine?
The IUPAC name of (7Z,9Z)-5-ethyl-2-iodo-N-methylundeca-7,9-dien-1-amine (CID 146336875) is (7Z,9Z)-5-ethyl-2-iodo-N-methylundeca-7,9-dien-1-amine.
What is the SMILES notation for (7Z,9Z)-5-ethyl-2-iodo-N-methylundeca-7,9-dien-1-amine?
The canonical SMILES for (7Z,9Z)-5-ethyl-2-iodo-N-methylundeca-7,9-dien-1-amine is C/C=C\C=C/CC(CC)CCC(I)CNC.
What is the InChIKey of (7Z,9Z)-5-ethyl-2-iodo-N-methylundeca-7,9-dien-1-amine?
The InChIKey is CSWPIOUWZKVGHG-MOIRPGTBSA-N. The full InChI is InChI=1S/C14H26IN/c1-4-6-7-8-9-13(5-2)10-11-14(15)12-16-3/h4,6-8,13-14,16H,5,9-12H2,1-3H3/b6-4-,8-7-.
What are the key properties of (7Z,9Z)-5-ethyl-2-iodo-N-methylundeca-7,9-dien-1-amine?
(7Z,9Z)-5-ethyl-2-iodo-N-methylundeca-7,9-dien-1-amine has a molecular weight of 335.27 g/mol, XLogP of 4.34, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (7Z,9Z)-5-ethyl-2-iodo-N-methylundeca-7,9-dien-1-amine is sourced from PubChem (CID 146336875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).