C20H43N3O5S — CID 146337570
1-[3,5-dihydroxy-1-(2,3,4-trihydroxybutylamino)heptan-2-yl]-3-(2,4,4-trimethylpentan-2-yl)thiourea (PubChem CID 146337570) has the molecular formula C20H43N3O5S and a molecular weight of 437.65 g/mol. Its IUPAC name is 1-[3,5-dihydroxy-1-(2,3,4-trihydroxybutylamino)heptan-2-yl]-3-(2,4,4-trimethylpentan-2-yl)thiourea.
| Compound Name | 1-[3,5-dihydroxy-1-(2,3,4-trihydroxybutylamino)heptan-2-yl]-3-(2,4,4-trimethylpentan-2-yl)thiourea |
|---|---|
| PubChem CID | 146337570 |
| Molecular Formula | C20H43N3O5S |
| Molecular Weight | 437.65 g/mol |
| Exact Mass | 437.29 |
| IUPAC Name | 1-[3,5-dihydroxy-1-(2,3,4-trihydroxybutylamino)heptan-2-yl]-3-(2,4,4-trimethylpentan-2-yl)thiourea |
| SMILES | CCC(O)CC(O)C(CNCC(O)C(O)CO)NC(=S)NC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C20H43N3O5S/c1-7-13(25)8-15(26)14(9-21-10-16(27)17(28)11-24)22-18(29)23-20(5,6)12-19(2,3)4/h13-17,21,24-28H,7-12H2,1-6H3,(H2,22,23,29) |
| InChIKey | DXOFOCZECVFIMA-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 137.24 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.65 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|