C33H33N9O5 — CID 146338161
methyl 4-[5-[[(12Z)-9,18-dioxo-20-oxa-2,4,6,10,17,24-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaen-5-yl]amino]indol-1-yl]piperidine-1-carboxylate (PubChem CID 146338161) has the molecular formula C33H33N9O5 and a molecular weight of 635.69 g/mol. Its IUPAC name is methyl 4-[5-[[(12Z)-9,18-dioxo-20-oxa-2,4,6,10,17,24-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaen-5-yl]amino]indol-1-yl]piperidine-1-carboxylate.
| Compound Name | methyl 4-[5-[[(12Z)-9,18-dioxo-20-oxa-2,4,6,10,17,24-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaen-5-yl]amino]indol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 146338161 |
| Molecular Formula | C33H33N9O5 |
| Molecular Weight | 635.69 g/mol |
| Exact Mass | 635.26 |
| IUPAC Name | methyl 4-[5-[[(12Z)-9,18-dioxo-20-oxa-2,4,6,10,17,24-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaen-5-yl]amino]indol-1-yl]piperidine-1-carboxylate |
| SMILES | COC(=O)N1CCC(n2ccc3cc(Nc4ncc5c(=O)n6n(c5n4)-c4ccc5c(n4)N(CCC/C=C\C6)C(=O)CO5)ccc32)CC1 |
| InChI | InChI=1S/C33H33N9O5/c1-46-33(45)38-15-11-23(12-16-38)39-17-10-21-18-22(6-7-25(21)39)35-32-34-19-24-29(37-32)42-27-9-8-26-30(36-27)40(28(43)20-47-26)13-4-2-3-5-14-41(42)31(24)44/h3,5-10,17-19,23H,2,4,11-16,20H2,1H3,(H,34,35,37)/b5-3- |
| InChIKey | RLJZCQSHNBFGCJ-HYXAFXHYSA-N |
| XLogP | 4.15 |
| TPSA | 141.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.69 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|