C30H29N9O3 — CID 146338164
(12Z)-5-[(2-methyl-3,4-dihydro-1H-pyrazino[1,2-a]indol-8-yl)amino]-20-oxa-2,4,6,10,17,24-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaene-9,18-dione (PubChem CID 146338164) has the molecular formula C30H29N9O3 and a molecular weight of 563.62 g/mol. Its IUPAC name is (12Z)-5-[(2-methyl-3,4-dihydro-1H-pyrazino[1,2-a]indol-8-yl)amino]-20-oxa-2,4,6,10,17,24-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaene-9,18-dione.
| Compound Name | (12Z)-5-[(2-methyl-3,4-dihydro-1H-pyrazino[1,2-a]indol-8-yl)amino]-20-oxa-2,4,6,10,17,24-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaene-9,18-dione |
|---|---|
| PubChem CID | 146338164 |
| Molecular Formula | C30H29N9O3 |
| Molecular Weight | 563.62 g/mol |
| Exact Mass | 563.24 |
| IUPAC Name | (12Z)-5-[(2-methyl-3,4-dihydro-1H-pyrazino[1,2-a]indol-8-yl)amino]-20-oxa-2,4,6,10,17,24-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaene-9,18-dione |
| SMILES | CN1CCn2c(cc3cc(Nc4ncc5c(=O)n6n(c5n4)-c4ccc5c(n4)N(CCC/C=C\C6)C(=O)CO5)ccc32)C1 |
| InChI | InChI=1S/C30H29N9O3/c1-35-12-13-36-21(17-35)15-19-14-20(6-7-23(19)36)32-30-31-16-22-27(34-30)39-25-9-8-24-28(33-25)37(26(40)18-42-24)10-4-2-3-5-11-38(39)29(22)41/h3,5-9,14-16H,2,4,10-13,17-18H2,1H3,(H,31,32,34)/b5-3- |
| InChIKey | SBRUKLVGKXBLCC-HYXAFXHYSA-N |
| XLogP | 3.20 |
| TPSA | 115.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.62 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|