About N,2-dimethyl-2,3-dihydrothiophen-3-amine
N,2-dimethyl-2,3-dihydrothiophen-3-amine (PubChem CID 146338252) has the molecular formula C6H11NS
and a molecular weight of 129.23 g/mol. Its IUPAC name is N,2-dimethyl-2,3-dihydrothiophen-3-amine.
Molecular Properties
| Compound Name | N,2-dimethyl-2,3-dihydrothiophen-3-amine |
| PubChem CID | 146338252 |
| Molecular Formula | C6H11NS |
| Molecular Weight | 129.23 g/mol |
| Exact Mass | 129.06 |
| IUPAC Name | N,2-dimethyl-2,3-dihydrothiophen-3-amine |
| SMILES | CNC1C=CSC1C |
| InChI | InChI=1S/C6H11NS/c1-5-6(7-2)3-4-8-5/h3-7H,1-2H3 |
| InChIKey | SDJBDGSBWLICKQ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.23 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,2-dimethyl-2,3-dihydrothiophen-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,2-dimethyl-2,3-dihydrothiophen-3-amine?
The IUPAC name of N,2-dimethyl-2,3-dihydrothiophen-3-amine (CID 146338252) is N,2-dimethyl-2,3-dihydrothiophen-3-amine.
What is the SMILES notation for N,2-dimethyl-2,3-dihydrothiophen-3-amine?
The canonical SMILES for N,2-dimethyl-2,3-dihydrothiophen-3-amine is CNC1C=CSC1C.
What is the InChIKey of N,2-dimethyl-2,3-dihydrothiophen-3-amine?
The InChIKey is SDJBDGSBWLICKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NS/c1-5-6(7-2)3-4-8-5/h3-7H,1-2H3.
What are the key properties of N,2-dimethyl-2,3-dihydrothiophen-3-amine?
N,2-dimethyl-2,3-dihydrothiophen-3-amine has a molecular weight of 129.23 g/mol, XLogP of 1.22, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,2-dimethyl-2,3-dihydrothiophen-3-amine is sourced from PubChem (CID 146338252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).