About N-tert-butyl-N-(2,2-dimethylpropyl)-2,2-dimethylpentan-3-amine
N-tert-butyl-N-(2,2-dimethylpropyl)-2,2-dimethylpentan-3-amine (PubChem CID 146338331) has the molecular formula C16H35N
and a molecular weight of 241.46 g/mol. Its IUPAC name is N-tert-butyl-N-(2,2-dimethylpropyl)-2,2-dimethylpentan-3-amine.
Molecular Properties
| Compound Name | N-tert-butyl-N-(2,2-dimethylpropyl)-2,2-dimethylpentan-3-amine |
| PubChem CID | 146338331 |
| Molecular Formula | C16H35N |
| Molecular Weight | 241.46 g/mol |
| Exact Mass | 241.28 |
| IUPAC Name | N-tert-butyl-N-(2,2-dimethylpropyl)-2,2-dimethylpentan-3-amine |
| SMILES | CCC(N(CC(C)(C)C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C16H35N/c1-11-13(15(5,6)7)17(16(8,9)10)12-14(2,3)4/h13H,11-12H2,1-10H3 |
| InChIKey | HFUNUPFARUELIQ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.46 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-tert-butyl-N-(2,2-dimethylpropyl)-2,2-dimethylpentan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-N-(2,2-dimethylpropyl)-2,2-dimethylpentan-3-amine?
The IUPAC name of N-tert-butyl-N-(2,2-dimethylpropyl)-2,2-dimethylpentan-3-amine (CID 146338331) is N-tert-butyl-N-(2,2-dimethylpropyl)-2,2-dimethylpentan-3-amine.
What is the SMILES notation for N-tert-butyl-N-(2,2-dimethylpropyl)-2,2-dimethylpentan-3-amine?
The canonical SMILES for N-tert-butyl-N-(2,2-dimethylpropyl)-2,2-dimethylpentan-3-amine is CCC(N(CC(C)(C)C)C(C)(C)C)C(C)(C)C.
What is the InChIKey of N-tert-butyl-N-(2,2-dimethylpropyl)-2,2-dimethylpentan-3-amine?
The InChIKey is HFUNUPFARUELIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H35N/c1-11-13(15(5,6)7)17(16(8,9)10)12-14(2,3)4/h13H,11-12H2,1-10H3.
What are the key properties of N-tert-butyl-N-(2,2-dimethylpropyl)-2,2-dimethylpentan-3-amine?
N-tert-butyl-N-(2,2-dimethylpropyl)-2,2-dimethylpentan-3-amine has a molecular weight of 241.46 g/mol, XLogP of 4.96, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-N-(2,2-dimethylpropyl)-2,2-dimethylpentan-3-amine is sourced from PubChem (CID 146338331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).