C30H33N9O4 — CID 146338333
(12Z)-5-[3-(hydroxymethyl)-4-(4-methylpiperazin-1-yl)anilino]-20-oxa-2,4,6,10,17,24-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaene-9,18-dione (PubChem CID 146338333) has the molecular formula C30H33N9O4 and a molecular weight of 583.65 g/mol. Its IUPAC name is (12Z)-5-[3-(hydroxymethyl)-4-(4-methylpiperazin-1-yl)anilino]-20-oxa-2,4,6,10,17,24-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaene-9,18-dione.
| Compound Name | (12Z)-5-[3-(hydroxymethyl)-4-(4-methylpiperazin-1-yl)anilino]-20-oxa-2,4,6,10,17,24-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaene-9,18-dione |
|---|---|
| PubChem CID | 146338333 |
| Molecular Formula | C30H33N9O4 |
| Molecular Weight | 583.65 g/mol |
| Exact Mass | 583.27 |
| IUPAC Name | (12Z)-5-[3-(hydroxymethyl)-4-(4-methylpiperazin-1-yl)anilino]-20-oxa-2,4,6,10,17,24-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaene-9,18-dione |
| SMILES | CN1CCN(c2ccc(Nc3ncc4c(=O)n5n(c4n3)-c3ccc4c(n3)N(CCC/C=C/C5)C(=O)CO4)cc2CO)CC1 |
| InChI | InChI=1S/C30H33N9O4/c1-35-12-14-36(15-13-35)23-7-6-21(16-20(23)18-40)32-30-31-17-22-27(34-30)39-25-9-8-24-28(33-25)37(26(41)19-43-24)10-4-2-3-5-11-38(39)29(22)42/h3,5-9,16-17,40H,2,4,10-15,18-19H2,1H3,(H,31,32,34)/b5-3+ |
| InChIKey | ZIUCRLUXTOHYAO-HWKANZROSA-N |
| XLogP | 2.04 |
| TPSA | 133.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.65 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|