C33H35N9O4 — CID 146338434
(12Z)-5-[[1-[1-(2-hydroxyethyl)piperidin-4-yl]indol-5-yl]amino]-20-oxa-2,4,6,10,17,24-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaene-9,18-dione (PubChem CID 146338434) has the molecular formula C33H35N9O4 and a molecular weight of 621.70 g/mol. Its IUPAC name is (12Z)-5-[[1-[1-(2-hydroxyethyl)piperidin-4-yl]indol-5-yl]amino]-20-oxa-2,4,6,10,17,24-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaene-9,18-dione.
| Compound Name | (12Z)-5-[[1-[1-(2-hydroxyethyl)piperidin-4-yl]indol-5-yl]amino]-20-oxa-2,4,6,10,17,24-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaene-9,18-dione |
|---|---|
| PubChem CID | 146338434 |
| Molecular Formula | C33H35N9O4 |
| Molecular Weight | 621.70 g/mol |
| Exact Mass | 621.28 |
| IUPAC Name | (12Z)-5-[[1-[1-(2-hydroxyethyl)piperidin-4-yl]indol-5-yl]amino]-20-oxa-2,4,6,10,17,24-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaene-9,18-dione |
| SMILES | O=C1COc2ccc3nc2N1CCC/C=C\Cn1c(=O)c2cnc(Nc4ccc5c(ccn5C5CCN(CCO)CC5)c4)nc2n1-3 |
| InChI | InChI=1S/C33H35N9O4/c43-18-17-38-14-10-24(11-15-38)39-16-9-22-19-23(5-6-26(22)39)35-33-34-20-25-30(37-33)42-28-8-7-27-31(36-28)40(29(44)21-46-27)12-3-1-2-4-13-41(42)32(25)45/h2,4-9,16,19-20,24,43H,1,3,10-15,17-18,21H2,(H,34,35,37)/b4-2- |
| InChIKey | XHYAOAVYPMUXIF-RQOWECAXSA-N |
| XLogP | 3.38 |
| TPSA | 135.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.70 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|